C16H21N — CID 145177333
10-butan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole (PubChem CID 145177333) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 10-butan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole.
| Compound Name | 10-butan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 145177333 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 10-butan-2-yl-6,7,8,9-tetrahydropyrido[1,2-a]indole |
| SMILES | CCC(C)c1c2n(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C16H21N/c1-3-12(2)16-13-8-4-5-9-14(13)17-11-7-6-10-15(16)17/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3 |
| InChIKey | YXPQWQQYQDMDKU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|