C13H12N2 — CID 10442668
6,7,8,9-tetrahydropyrido[1,2-a]indole-10-carbonitrile (PubChem CID 10442668) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrido[1,2-a]indole-10-carbonitrile.
| Compound Name | 6,7,8,9-tetrahydropyrido[1,2-a]indole-10-carbonitrile |
|---|---|
| PubChem CID | 10442668 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 6,7,8,9-tetrahydropyrido[1,2-a]indole-10-carbonitrile |
| SMILES | N#Cc1c2n(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C13H12N2/c14-9-11-10-5-1-2-6-12(10)15-8-4-3-7-13(11)15/h1-2,5-6H,3-4,7-8H2 |
| InChIKey | HUWRPEWZWOKPBK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |