C14H15N — CID 11074354
4-prop-2-enyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole (PubChem CID 11074354) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-prop-2-enyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole.
| Compound Name | 4-prop-2-enyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
|---|---|
| PubChem CID | 11074354 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-prop-2-enyl-2,3-dihydro-1H-pyrrolo[1,2-a]indole |
| SMILES | C=CCc1c2n(c3ccccc13)CCC2 |
| InChI | InChI=1S/C14H15N/c1-2-6-11-12-7-3-4-8-13(12)15-10-5-9-14(11)15/h2-4,7-8H,1,5-6,9-10H2 |
| InChIKey | UFCSYFJBPRKYQC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|