C18H23NO5S — CID 59487252
propyl 2-(7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate (PubChem CID 59487252) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is propyl 2-(7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate.
| Compound Name | propyl 2-(7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
|---|---|
| PubChem CID | 59487252 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | propyl 2-(7-methylsulfonyloxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
| SMILES | CCCOC(=O)Cc1c2n(c3ccccc13)CC(OS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C18H23NO5S/c1-3-10-23-18(20)11-15-14-6-4-5-7-16(14)19-12-13(8-9-17(15)19)24-25(2,21)22/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | QXRARIDYURZWHC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|