C19H24FNO5S — CID 91308691
propyl 2-(6-fluoro-4-methyl-3-methylsulfonyloxy-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl)acetate (PubChem CID 91308691) has the molecular formula C19H24FNO5S and a molecular weight of 397.47 g/mol. Its IUPAC name is propyl 2-(6-fluoro-4-methyl-3-methylsulfonyloxy-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl)acetate.
| Compound Name | propyl 2-(6-fluoro-4-methyl-3-methylsulfonyloxy-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
|---|---|
| PubChem CID | 91308691 |
| Molecular Formula | C19H24FNO5S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | propyl 2-(6-fluoro-4-methyl-3-methylsulfonyloxy-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl)acetate |
| SMILES | CCCOC(=O)Cc1c2c(n3c(F)cccc13)C(C)C(OS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C19H24FNO5S/c1-4-10-25-18(22)11-14-13-8-9-16(26-27(3,23)24)12(2)19(13)21-15(14)6-5-7-17(21)20/h5-7,12,16H,4,8-11H2,1-3H3 |
| InChIKey | KJKUDHHPOQFKJM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|