C17H21NO5S — CID 58034247
ethyl 2-(9-methylsulfonyloxy-7,8,9,10-tetrahydropyrido[1,2-b]isoindol-6-yl)acetate (PubChem CID 58034247) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is ethyl 2-(9-methylsulfonyloxy-7,8,9,10-tetrahydropyrido[1,2-b]isoindol-6-yl)acetate.
| Compound Name | ethyl 2-(9-methylsulfonyloxy-7,8,9,10-tetrahydropyrido[1,2-b]isoindol-6-yl)acetate |
|---|---|
| PubChem CID | 58034247 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 2-(9-methylsulfonyloxy-7,8,9,10-tetrahydropyrido[1,2-b]isoindol-6-yl)acetate |
| SMILES | CCOC(=O)Cc1c2c(c3ccccn13)CC(OS(C)(=O)=O)CC2 |
| InChI | InChI=1S/C17H21NO5S/c1-3-22-17(19)11-16-13-8-7-12(23-24(2,20)21)10-14(13)15-6-4-5-9-18(15)16/h4-6,9,12H,3,7-8,10-11H2,1-2H3 |
| InChIKey | WSECCMSMGMXMMP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|