C18H22N2O2 — CID 89052981
methyl 2-[3-(prop-2-enylamino)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]acetate (PubChem CID 89052981) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is methyl 2-[3-(prop-2-enylamino)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]acetate.
| Compound Name | methyl 2-[3-(prop-2-enylamino)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
|---|---|
| PubChem CID | 89052981 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | methyl 2-[3-(prop-2-enylamino)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]acetate |
| SMILES | C=CCNC1CCc2c(CC(=O)OC)c3ccccn3c2C1 |
| InChI | InChI=1S/C18H22N2O2/c1-3-9-19-13-7-8-14-15(12-18(21)22-2)16-6-4-5-10-20(16)17(14)11-13/h3-6,10,13,19H,1,7-9,11-12H2,2H3 |
| InChIKey | XVUZJJOXNNXQGW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|