C13H17NO — CID 18331831
7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 18331831) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | 7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 18331831 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 7-(prop-2-enylamino)-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | C=CCNC1CCc2cccc(O)c2C1 |
| InChI | InChI=1S/C13H17NO/c1-2-8-14-11-7-6-10-4-3-5-13(15)12(10)9-11/h2-5,11,14-15H,1,6-9H2 |
| InChIKey | YGRVYICNGRCKOP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|