About methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate
methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate (PubChem CID 54298591) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate.
Analyze methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate?
The IUPAC name of methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate (CID 54298591) is methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate.
What is the SMILES notation for methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate?
The canonical SMILES for methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate is COC(=O)CC1CCc2cccc(O)c2C1.
What is the InChIKey of methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate?
The InChIKey is SCNYRRSDPCHAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-16-13(15)8-9-5-6-10-3-2-4-12(14)11(10)7-9/h2-4,9,14H,5-8H2,1H3.
What are the key properties of methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate?
methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate has a molecular weight of 220.27 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(8-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)acetate is sourced from PubChem (CID 54298591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).