About methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate
methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate (PubChem CID 59590848) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate.
Analyze methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate?
The IUPAC name of methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate (CID 59590848) is methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate.
What is the SMILES notation for methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate?
The canonical SMILES for methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate is COC(=O)C[C@@H]1CCc2cc(O)ccc21.
What is the InChIKey of methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate?
The InChIKey is NQOXEXXDMBLLTO-VIFPVBQESA-N. The full InChI is InChI=1S/C12H14O3/c1-15-12(14)7-9-3-2-8-6-10(13)4-5-11(8)9/h4-6,9,13H,2-3,7H2,1H3/t9-/m0/s1.
What are the key properties of methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate?
methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate has a molecular weight of 206.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1S)-5-hydroxy-2,3-dihydro-1H-inden-1-yl]acetate is sourced from PubChem (CID 59590848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).