About benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate
benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate (PubChem CID 158789867) has the molecular formula C17H18O6
and a molecular weight of 318.32 g/mol. Its IUPAC name is benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate.
Molecular Properties
| Compound Name | benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate |
| PubChem CID | 158789867 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate |
| SMILES | COC(=O)CC1COc2cc(O)ccc21.Oc1cccc(O)c1 |
| InChI | InChI=1S/C11H12O4.C6H6O2/c1-14-11(13)4-7-6-15-10-5-8(12)2-3-9(7)10;7-5-2-1-3-6(8)4-5/h2-3,5,7,12H,4,6H2,1H3;1-4,7-8H |
| InChIKey | ISDFOMMCELBSGX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate?
The IUPAC name of benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate (CID 158789867) is benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate.
What is the SMILES notation for benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate?
The canonical SMILES for benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate is COC(=O)CC1COc2cc(O)ccc21.Oc1cccc(O)c1.
What is the InChIKey of benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate?
The InChIKey is ISDFOMMCELBSGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4.C6H6O2/c1-14-11(13)4-7-6-15-10-5-8(12)2-3-9(7)10;7-5-2-1-3-6(8)4-5/h2-3,5,7,12H,4,6H2,1H3;1-4,7-8H.
What are the key properties of benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate?
benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate has a molecular weight of 318.32 g/mol, XLogP of 2.53, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;methyl 2-(6-hydroxy-2,3-dihydro-1-benzofuran-3-yl)acetate is sourced from PubChem (CID 158789867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).