C12H13BrO2 — CID 131278593
methyl 2-(4-bromo-2,3-dihydro-1H-inden-1-yl)acetate (PubChem CID 131278593) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is methyl 2-(4-bromo-2,3-dihydro-1H-inden-1-yl)acetate.
| Compound Name | methyl 2-(4-bromo-2,3-dihydro-1H-inden-1-yl)acetate |
|---|---|
| PubChem CID | 131278593 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | methyl 2-(4-bromo-2,3-dihydro-1H-inden-1-yl)acetate |
| SMILES | COC(=O)CC1CCc2c(Br)cccc21 |
| InChI | InChI=1S/C12H13BrO2/c1-15-12(14)7-8-5-6-10-9(8)3-2-4-11(10)13/h2-4,8H,5-7H2,1H3 |
| InChIKey | UCCBDJPYTCBSBT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |