1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid

C12H14O3 — CID 105458629

IUPAC1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid
SMILESCOCC1CCc2c(C(=O)O)cccc21
InChIInChI=1S/C12H14O3/c1-15-7-8-5-6-10-9(8)3-2-4-11(10)12(13)14/h2-4,8H,5-7H2,1H3,(H,13,14)
InChIKeyXXJQTPOOOMQRNR-UHFFFAOYSA-N
MW206.24 g/mol
LogP2.06
Rot. Bonds3

About 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid

1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid (PubChem CID 105458629) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid.

Molecular Properties

Compound Name1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid
PubChem CID105458629
Molecular FormulaC12H14O3
Molecular Weight206.24 g/mol
Exact Mass206.09
IUPAC Name1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid
SMILESCOCC1CCc2c(C(=O)O)cccc21
InChIInChI=1S/C12H14O3/c1-15-7-8-5-6-10-9(8)3-2-4-11(10)12(13)14/h2-4,8H,5-7H2,1H3,(H,13,14)
InChIKeyXXJQTPOOOMQRNR-UHFFFAOYSA-N
XLogP2.06
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.24
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid?
The IUPAC name of 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid (CID 105458629) is 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid.
What is the SMILES notation for 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid?
The canonical SMILES for 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid is COCC1CCc2c(C(=O)O)cccc21.
What is the InChIKey of 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid?
The InChIKey is XXJQTPOOOMQRNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-15-7-8-5-6-10-9(8)3-2-4-11(10)12(13)14/h2-4,8H,5-7H2,1H3,(H,13,14).
What are the key properties of 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid?
1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid has a molecular weight of 206.24 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-2,3-dihydro-1H-indene-4-carboxylic acid is sourced from PubChem (CID 105458629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).