About 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid
5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 105474285) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
Analyze 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The IUPAC name of 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CID 105474285) is 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
What is the SMILES notation for 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The canonical SMILES for 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid is CCNC1CCCc2c(C(=O)O)cccc21.
What is the InChIKey of 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The InChIKey is FUGWPNTZVKEYFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-2-14-12-8-4-5-9-10(12)6-3-7-11(9)13(15)16/h3,6-7,12,14H,2,4-5,8H2,1H3,(H,15,16).
What are the key properties of 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid has a molecular weight of 219.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid is sourced from PubChem (CID 105474285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).