C19H21N3O3 — CID 167863301
5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 167863301) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 167863301 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)NC2CCCc3c(C(=O)O)cccc32)N=N1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-3-11-19(21-22-19)12-10-17(23)20-16-9-5-6-13-14(16)7-4-8-15(13)18(24)25/h1,4,7-8,16H,3,5-6,9-12H2,(H,20,23)(H,24,25) |
| InChIKey | VQDLAEORHYABAD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|