C14H14N4O4 — CID 166430204
5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 166430204) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 166430204 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)Nc2c[nH]c(=O)c(C(=O)O)c2)N=N1 |
| InChI | InChI=1S/C14H14N4O4/c1-2-3-5-14(17-18-14)6-4-11(19)16-9-7-10(13(21)22)12(20)15-8-9/h1,7-8H,3-6H2,(H,15,20)(H,16,19)(H,21,22) |
| InChIKey | JZMNMODOMFNXQD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|