C16H17N3O3 — CID 154772238
2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-6-methylbenzoic acid (PubChem CID 154772238) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-6-methylbenzoic acid.
| Compound Name | 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-6-methylbenzoic acid |
|---|---|
| PubChem CID | 154772238 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-6-methylbenzoic acid |
| SMILES | C#CCCC1(CCC(=O)Nc2cccc(C)c2C(=O)O)N=N1 |
| InChI | InChI=1S/C16H17N3O3/c1-3-4-9-16(18-19-16)10-8-13(20)17-12-7-5-6-11(2)14(12)15(21)22/h1,5-7H,4,8-10H2,2H3,(H,17,20)(H,21,22) |
| InChIKey | ZUZNWLZUJCDYRQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|