C19H21N5O3 — CID 167985049
3-(3-but-3-ynyldiazirin-3-yl)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanamide (PubChem CID 167985049) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 167985049 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[3-(2,6-dioxo-1,3-diazinan-1-yl)-2-methylphenyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2cccc(N3C(=O)CCNC3=O)c2C)N=N1 |
| InChI | InChI=1S/C19H21N5O3/c1-3-4-10-19(22-23-19)11-8-16(25)21-14-6-5-7-15(13(14)2)24-17(26)9-12-20-18(24)27/h1,5-7H,4,8-12H2,2H3,(H,20,27)(H,21,25) |
| InChIKey | CBBNWLQSDUDWPW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|