C16H16N6O — CID 166417896
3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)propanamide (PubChem CID 166417896) has the molecular formula C16H16N6O and a molecular weight of 308.34 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 166417896 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2cn[nH]c2-c2ccccn2)N=N1 |
| InChI | InChI=1S/C16H16N6O/c1-2-3-8-16(21-22-16)9-7-14(23)19-13-11-18-20-15(13)12-6-4-5-10-17-12/h1,4-6,10-11H,3,7-9H2,(H,18,20)(H,19,23) |
| InChIKey | JEMDSKUMKBDTMG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|