C16H19N3O3 — CID 167922696
3-(3-but-3-ynyldiazirin-3-yl)-N-(2,3-dimethoxyphenyl)propanamide (PubChem CID 167922696) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-(2,3-dimethoxyphenyl)propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(2,3-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 167922696 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-(2,3-dimethoxyphenyl)propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2cccc(OC)c2OC)N=N1 |
| InChI | InChI=1S/C16H19N3O3/c1-4-5-10-16(18-19-16)11-9-14(20)17-12-7-6-8-13(21-2)15(12)22-3/h1,6-8H,5,9-11H2,2-3H3,(H,17,20) |
| InChIKey | YANDDCXGFYDRRD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|