C19H21N5O4 — CID 166423387
methyl 7-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-(methoxymethyl)indazole-3-carboxylate (PubChem CID 166423387) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 7-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-(methoxymethyl)indazole-3-carboxylate.
| Compound Name | methyl 7-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-(methoxymethyl)indazole-3-carboxylate |
|---|---|
| PubChem CID | 166423387 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl 7-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1-(methoxymethyl)indazole-3-carboxylate |
| SMILES | C#CCCC1(CCC(=O)Nc2cccc3c(C(=O)OC)nn(COC)c23)N=N1 |
| InChI | InChI=1S/C19H21N5O4/c1-4-5-10-19(22-23-19)11-9-15(25)20-14-8-6-7-13-16(18(26)28-3)21-24(12-27-2)17(13)14/h1,6-8H,5,9-12H2,2-3H3,(H,20,25) |
| InChIKey | DSKXLSHMJKHNAB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|