C19H22N4O4 — CID 166423261
methyl 2-[[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl-methylamino]acetyl]amino]benzoate (PubChem CID 166423261) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl-methylamino]acetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl-methylamino]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 166423261 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | methyl 2-[[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl-methylamino]acetyl]amino]benzoate |
| SMILES | C#CCCC1(CCC(=O)N(C)CC(=O)Nc2ccccc2C(=O)OC)N=N1 |
| InChI | InChI=1S/C19H22N4O4/c1-4-5-11-19(21-22-19)12-10-17(25)23(2)13-16(24)20-15-9-7-6-8-14(15)18(26)27-3/h1,6-9H,5,10-13H2,2-3H3,(H,20,24) |
| InChIKey | PZEJAFQOWUQCPK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|