C16H16FN3O4 — CID 167901371
4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5-fluoro-2-methoxybenzoic acid (PubChem CID 167901371) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5-fluoro-2-methoxybenzoic acid.
| Compound Name | 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5-fluoro-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 167901371 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-5-fluoro-2-methoxybenzoic acid |
| SMILES | C#CCCC1(CCC(=O)Nc2cc(OC)c(C(=O)O)cc2F)N=N1 |
| InChI | InChI=1S/C16H16FN3O4/c1-3-4-6-16(19-20-16)7-5-14(21)18-12-9-13(24-2)10(15(22)23)8-11(12)17/h1,8-9H,4-7H2,2H3,(H,18,21)(H,22,23) |
| InChIKey | XGVQPVYRVFOODM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|