C17H17F2N3O4 — CID 166430454
4-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,1-difluoroethoxy]benzoic acid (PubChem CID 166430454) has the molecular formula C17H17F2N3O4 and a molecular weight of 365.34 g/mol. Its IUPAC name is 4-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,1-difluoroethoxy]benzoic acid.
| Compound Name | 4-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,1-difluoroethoxy]benzoic acid |
|---|---|
| PubChem CID | 166430454 |
| Molecular Formula | C17H17F2N3O4 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,1-difluoroethoxy]benzoic acid |
| SMILES | C#CCCC1(CCC(=O)NCC(F)(F)Oc2ccc(C(=O)O)cc2)N=N1 |
| InChI | InChI=1S/C17H17F2N3O4/c1-2-3-9-16(21-22-16)10-8-14(23)20-11-17(18,19)26-13-6-4-12(5-7-13)15(24)25/h1,4-7H,3,8-11H2,(H,20,23)(H,24,25) |
| InChIKey | NFRBWZVAHYMERA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|