C18H19N5O — CID 166417680
3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(pyrazol-1-ylmethyl)phenyl]propanamide (PubChem CID 166417680) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(pyrazol-1-ylmethyl)phenyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(pyrazol-1-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 166417680 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[4-(pyrazol-1-ylmethyl)phenyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2ccc(Cn3cccn3)cc2)N=N1 |
| InChI | InChI=1S/C18H19N5O/c1-2-3-10-18(21-22-18)11-9-17(24)20-16-7-5-15(6-8-16)14-23-13-4-12-19-23/h1,4-8,12-13H,3,9-11,14H2,(H,20,24) |
| InChIKey | ZPBGFDBGHFYIKR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|