C17H16N6O3 — CID 154772233
1-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]phenyl]triazole-4-carboxylic acid (PubChem CID 154772233) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is 1-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]phenyl]triazole-4-carboxylic acid.
| Compound Name | 1-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 154772233 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 1-[4-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]phenyl]triazole-4-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)Nc2ccc(-n3cc(C(=O)O)nn3)cc2)N=N1 |
| InChI | InChI=1S/C17H16N6O3/c1-2-3-9-17(20-21-17)10-8-15(24)18-12-4-6-13(7-5-12)23-11-14(16(25)26)19-22-23/h1,4-7,11H,3,8-10H2,(H,18,24)(H,25,26) |
| InChIKey | AOJDLQXEYZURJE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|