C16H16BrN7O — CID 166429464
N-[[1-(4-bromophenyl)tetrazol-5-yl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide (PubChem CID 166429464) has the molecular formula C16H16BrN7O and a molecular weight of 402.26 g/mol. Its IUPAC name is N-[[1-(4-bromophenyl)tetrazol-5-yl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide.
| Compound Name | N-[[1-(4-bromophenyl)tetrazol-5-yl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 166429464 |
| Molecular Formula | C16H16BrN7O |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N-[[1-(4-bromophenyl)tetrazol-5-yl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
| SMILES | C#CCCC1(CCC(=O)NCc2nnnn2-c2ccc(Br)cc2)N=N1 |
| InChI | InChI=1S/C16H16BrN7O/c1-2-3-9-16(20-21-16)10-8-15(25)18-11-14-19-22-23-24(14)13-6-4-12(17)5-7-13/h1,4-7H,3,8-11H2,(H,18,25) |
| InChIKey | IZBWUYDNBYVOLI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|