C20H24N8O — CID 166409249
3-(3-but-3-ynyldiazirin-3-yl)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 166409249) has the molecular formula C20H24N8O and a molecular weight of 392.47 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166409249 |
| Molecular Formula | C20H24N8O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | C#CCCC1(CCC(=O)N2CCN(Cc3nnnn3-c3ccccc3)CC2)N=N1 |
| InChI | InChI=1S/C20H24N8O/c1-2-3-10-20(22-23-20)11-9-19(29)27-14-12-26(13-15-27)16-18-21-24-25-28(18)17-7-5-4-6-8-17/h1,4-8H,3,9-16H2 |
| InChIKey | LVCZQMJKDKMQKZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|