C20H29N7O — CID 30738891
1-(azepan-1-yl)-2-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone (PubChem CID 30738891) has the molecular formula C20H29N7O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 30738891 |
| Molecular Formula | C20H29N7O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[(1-phenyltetrazol-5-yl)methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(Cc2nnnn2-c2ccccc2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C20H29N7O/c28-20(26-10-6-1-2-7-11-26)17-25-14-12-24(13-15-25)16-19-21-22-23-27(19)18-8-4-3-5-9-18/h3-5,8-9H,1-2,6-7,10-17H2 |
| InChIKey | OPVMMUFTAHMWBH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |