C17H20N4O3S — CID 166430512
3-(3-but-3-ynyldiazirin-3-yl)-1-(1,1-dioxo-6-phenyl-1,2,6-thiadiazinan-2-yl)propan-1-one (PubChem CID 166430512) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-1-(1,1-dioxo-6-phenyl-1,2,6-thiadiazinan-2-yl)propan-1-one.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-(1,1-dioxo-6-phenyl-1,2,6-thiadiazinan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 166430512 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-1-(1,1-dioxo-6-phenyl-1,2,6-thiadiazinan-2-yl)propan-1-one |
| SMILES | C#CCCC1(CCC(=O)N2CCCN(c3ccccc3)S2(=O)=O)N=N1 |
| InChI | InChI=1S/C17H20N4O3S/c1-2-3-11-17(18-19-17)12-10-16(22)21-14-7-13-20(25(21,23)24)15-8-5-4-6-9-15/h1,4-6,8-9H,3,7,10-14H2 |
| InChIKey | YHZWSVNPXKPZDA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|