C15H21N3O3 — CID 154788780
1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 154788780) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 154788780 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N2CCC(C)(C(=O)O)CC2)N=N1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-4-6-15(16-17-15)7-5-12(19)18-10-8-14(2,9-11-18)13(20)21/h1H,4-11H2,2H3,(H,20,21) |
| InChIKey | ZNWHBJDYOHFQCA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|