C16H23N3O3 — CID 167966338
(2R,3R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2-propan-2-ylpyrrolidine-3-carboxylic acid (PubChem CID 167966338) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2R,3R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2-propan-2-ylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2-propan-2-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 167966338 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2R,3R)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2-propan-2-ylpyrrolidine-3-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N2CC[C@@H](C(=O)O)[C@H]2C(C)C)N=N1 |
| InChI | InChI=1S/C16H23N3O3/c1-4-5-8-16(17-18-16)9-6-13(20)19-10-7-12(15(21)22)14(19)11(2)3/h1,11-12,14H,5-10H2,2-3H3,(H,21,22)/t12-,14-/m1/s1 |
| InChIKey | SWWOBSWKUXXLFP-TZMCWYRMSA-N |
| XLogP | 2.30 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|