C17H21N5O3 — CID 136574159
1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]pyrazole-3-carboxylic acid (PubChem CID 136574159) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 136574159 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-4-yl]pyrazole-3-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N2CCC(n3ccc(C(=O)O)n3)CC2)N=N1 |
| InChI | InChI=1S/C17H21N5O3/c1-2-3-8-17(19-20-17)9-4-15(23)21-10-5-13(6-11-21)22-12-7-14(18-22)16(24)25/h1,7,12-13H,3-6,8-11H2,(H,24,25) |
| InChIKey | YCYAZDQDTWOWST-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|