C17H20N4O3S — CID 167900470
2-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-3-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 167900470) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-3-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-3-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 167900470 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]piperidin-3-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N2CCCC(c3nc(C(=O)O)cs3)C2)N=N1 |
| InChI | InChI=1S/C17H20N4O3S/c1-2-3-7-17(19-20-17)8-6-14(22)21-9-4-5-12(10-21)15-18-13(11-25-15)16(23)24/h1,11-12H,3-10H2,(H,23,24) |
| InChIKey | CYRWFACFTZHUQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|