C20H29N3O3 — CID 166418218
ethyl (4aS,8aS)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,3,4,5,6,7,8,8a-octahydroquinoline-4a-carboxylate (PubChem CID 166418218) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl (4aS,8aS)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,3,4,5,6,7,8,8a-octahydroquinoline-4a-carboxylate.
| Compound Name | ethyl (4aS,8aS)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,3,4,5,6,7,8,8a-octahydroquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 166418218 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | ethyl (4aS,8aS)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,3,4,5,6,7,8,8a-octahydroquinoline-4a-carboxylate |
| SMILES | C#CCCC1(CCC(=O)N2CCC[C@@]3(C(=O)OCC)CCCC[C@H]23)N=N1 |
| InChI | InChI=1S/C20H29N3O3/c1-3-5-13-20(21-22-20)14-10-17(24)23-15-8-12-19(18(25)26-4-2)11-7-6-9-16(19)23/h1,16H,4-15H2,2H3/t16-,19-/m0/s1 |
| InChIKey | CWQGYAFWWRNLHY-LPHOPBHVSA-N |
| XLogP | 3.46 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|