C13H17N3O4 — CID 167800233
(2S,4S)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 167800233) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2S,4S)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167800233 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2S,4S)-1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | C#CCCC1(CCC(=O)N2C[C@@H](O)C[C@H]2C(=O)O)N=N1 |
| InChI | InChI=1S/C13H17N3O4/c1-2-3-5-13(14-15-13)6-4-11(18)16-8-9(17)7-10(16)12(19)20/h1,9-10,17H,3-8H2,(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | KLBPDMLHCOARPX-UWVGGRQHSA-N |
| XLogP | 0.39 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|