C21H29N5O5 — CID 166423353
tert-butyl 2-[8-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetate (PubChem CID 166423353) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl 2-[8-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetate.
| Compound Name | tert-butyl 2-[8-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
|---|---|
| PubChem CID | 166423353 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl 2-[8-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetate |
| SMILES | C#CCCC1(CCC(=O)N2CCC3(CC2)NC(=O)N(CC(=O)OC(C)(C)C)C3=O)N=N1 |
| InChI | InChI=1S/C21H29N5O5/c1-5-6-8-21(23-24-21)9-7-15(27)25-12-10-20(11-13-25)17(29)26(18(30)22-20)14-16(28)31-19(2,3)4/h1H,6-14H2,2-4H3,(H,22,30) |
| InChIKey | FXDJPPHCUQJKNO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|