C21H28N6O2 — CID 166417596
3-(3-but-3-ynyldiazirin-3-yl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]propanehydrazide (PubChem CID 166417596) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]propanehydrazide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]propanehydrazide |
|---|---|
| PubChem CID | 166417596 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]propanehydrazide |
| SMILES | C#CCCC1(CCC(=O)NNC(=O)CCN2CCN(c3ccccc3)CC2)N=N1 |
| InChI | InChI=1S/C21H28N6O2/c1-2-3-11-21(24-25-21)12-9-19(28)22-23-20(29)10-13-26-14-16-27(17-15-26)18-7-5-4-6-8-18/h1,4-8H,3,9-17H2,(H,22,28)(H,23,29) |
| InChIKey | LHHGJGMNOGBIGW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|