C22H27ClN4O2S — CID 4541503
N'-[3-(4-chlorophenyl)sulfanylpropanoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 4541503) has the molecular formula C22H27ClN4O2S and a molecular weight of 447.00 g/mol. Its IUPAC name is N'-[3-(4-chlorophenyl)sulfanylpropanoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-[3-(4-chlorophenyl)sulfanylpropanoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 4541503 |
| Molecular Formula | C22H27ClN4O2S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N'-[3-(4-chlorophenyl)sulfanylpropanoyl]-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NNC(=O)CCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN4O2S/c23-18-6-8-20(9-7-18)30-17-11-22(29)25-24-21(28)10-12-26-13-15-27(16-14-26)19-4-2-1-3-5-19/h1-9H,10-17H2,(H,24,28)(H,25,29) |
| InChIKey | AXXMBCSDQOWSHQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|