C28H31N5O2S — CID 4169019
N'-(3-phenothiazin-10-ylpropanoyl)-3-(4-phenylpiperazin-1-yl)propanehydrazide (PubChem CID 4169019) has the molecular formula C28H31N5O2S and a molecular weight of 501.66 g/mol. Its IUPAC name is N'-(3-phenothiazin-10-ylpropanoyl)-3-(4-phenylpiperazin-1-yl)propanehydrazide.
| Compound Name | N'-(3-phenothiazin-10-ylpropanoyl)-3-(4-phenylpiperazin-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 4169019 |
| Molecular Formula | C28H31N5O2S |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N'-(3-phenothiazin-10-ylpropanoyl)-3-(4-phenylpiperazin-1-yl)propanehydrazide |
| SMILES | O=C(CCN1CCN(c2ccccc2)CC1)NNC(=O)CCN1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C28H31N5O2S/c34-27(14-16-31-18-20-32(21-19-31)22-8-2-1-3-9-22)29-30-28(35)15-17-33-23-10-4-6-12-25(23)36-26-13-7-5-11-24(26)33/h1-13H,14-21H2,(H,29,34)(H,30,35) |
| InChIKey | BTVGEZCKDWNTRR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|