C21H24Cl2N4O3 — CID 29354060
3,5-dichloro-4-methoxy-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide (PubChem CID 29354060) has the molecular formula C21H24Cl2N4O3 and a molecular weight of 451.35 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide.
| Compound Name | 3,5-dichloro-4-methoxy-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 29354060 |
| Molecular Formula | C21H24Cl2N4O3 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N'-[3-(4-phenylpiperazin-1-yl)propanoyl]benzohydrazide |
| SMILES | COc1c(Cl)cc(C(=O)NNC(=O)CCN2CCN(c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C21H24Cl2N4O3/c1-30-20-17(22)13-15(14-18(20)23)21(29)25-24-19(28)7-8-26-9-11-27(12-10-26)16-5-3-2-4-6-16/h2-6,13-14H,7-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | KIQYUHWDEBWVGN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|