C24H31N5O3 — CID 18281862
3,4-dimethyl-N-[2-oxo-2-[2-[3-(4-phenylpiperazin-1-yl)propanoyl]hydrazinyl]ethyl]benzamide (PubChem CID 18281862) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-oxo-2-[2-[3-(4-phenylpiperazin-1-yl)propanoyl]hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-oxo-2-[2-[3-(4-phenylpiperazin-1-yl)propanoyl]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 18281862 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 3,4-dimethyl-N-[2-oxo-2-[2-[3-(4-phenylpiperazin-1-yl)propanoyl]hydrazinyl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCC(=O)NNC(=O)CCN2CCN(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C24H31N5O3/c1-18-8-9-20(16-19(18)2)24(32)25-17-23(31)27-26-22(30)10-11-28-12-14-29(15-13-28)21-6-4-3-5-7-21/h3-9,16H,10-15,17H2,1-2H3,(H,25,32)(H,26,30)(H,27,31) |
| InChIKey | BFYUVNCAKPINBH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|