C19H21N7O2 — CID 166423135
1-[4-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]ethyl]phenyl]triazole-4-carboxamide (PubChem CID 166423135) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[4-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]ethyl]phenyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]ethyl]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 166423135 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[4-[1-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]ethyl]phenyl]triazole-4-carboxamide |
| SMILES | C#CCCC1(CCC(=O)NC(C)c2ccc(-n3cc(C(N)=O)nn3)cc2)N=N1 |
| InChI | InChI=1S/C19H21N7O2/c1-3-4-10-19(23-24-19)11-9-17(27)21-13(2)14-5-7-15(8-6-14)26-12-16(18(20)28)22-25-26/h1,5-8,12-13H,4,9-11H2,2H3,(H2,20,28)(H,21,27) |
| InChIKey | QGFJQAUVIIMQFX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 127.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|