C17H19N5O — CID 166429954
3-(3-but-3-ynyldiazirin-3-yl)-N-[(1R)-1-imidazo[1,5-a]pyridin-3-ylethyl]propanamide (PubChem CID 166429954) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1R)-1-imidazo[1,5-a]pyridin-3-ylethyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1R)-1-imidazo[1,5-a]pyridin-3-ylethyl]propanamide |
|---|---|
| PubChem CID | 166429954 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[(1R)-1-imidazo[1,5-a]pyridin-3-ylethyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)N[C@H](C)c2ncc3ccccn23)N=N1 |
| InChI | InChI=1S/C17H19N5O/c1-3-4-9-17(20-21-17)10-8-15(23)19-13(2)16-18-12-14-7-5-6-11-22(14)16/h1,5-7,11-13H,4,8-10H2,2H3,(H,19,23)/t13-/m1/s1 |
| InChIKey | JAOHAZGZRNYFHV-CYBMUJFWSA-N |
| XLogP | 2.87 |
| TPSA | 71.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|