C19H21ClN4O — CID 146149775
3-(3-but-3-ynyldiazirin-3-yl)-N-[1-(6-chloro-1-methylindol-3-yl)ethyl]propanamide (PubChem CID 146149775) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-(6-chloro-1-methylindol-3-yl)ethyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-(6-chloro-1-methylindol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 146149775 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-(6-chloro-1-methylindol-3-yl)ethyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NC(C)c2cn(C)c3cc(Cl)ccc23)N=N1 |
| InChI | InChI=1S/C19H21ClN4O/c1-4-5-9-19(22-23-19)10-8-18(25)21-13(2)16-12-24(3)17-11-14(20)6-7-15(16)17/h1,6-7,11-13H,5,8-10H2,2-3H3,(H,21,25) |
| InChIKey | PSYSTGLIOOPZAR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 58.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|