C19H21N5O2 — CID 154773462
N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide (PubChem CID 154773462) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide.
| Compound Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 154773462 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[1-(3-benzyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
| SMILES | C#CCCC1(CCC(=O)NC(C)c2nc(Cc3ccccc3)no2)N=N1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-4-11-19(23-24-19)12-10-17(25)20-14(2)18-21-16(22-26-18)13-15-8-6-5-7-9-15/h1,5-9,14H,4,10-13H2,2H3,(H,20,25) |
| InChIKey | CTPQTUOLOYEGRD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|