C14H16N2O3 — CID 103500383
3-(3-benzyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid (PubChem CID 103500383) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid.
| Compound Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 103500383 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-(3-benzyl-1,2,4-oxadiazol-5-yl)-2-methylbutanoic acid |
| SMILES | CC(C(=O)O)C(C)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C14H16N2O3/c1-9(10(2)14(17)18)13-15-12(16-19-13)8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3,(H,17,18) |
| InChIKey | KJCAMFMKOQFUII-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |