C16H20N2O3 — CID 79481197
ethyl 2-(3-benzyl-1,2,4-oxadiazol-5-yl)-3-methylbutanoate (PubChem CID 79481197) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 2-(3-benzyl-1,2,4-oxadiazol-5-yl)-3-methylbutanoate.
| Compound Name | ethyl 2-(3-benzyl-1,2,4-oxadiazol-5-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 79481197 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 2-(3-benzyl-1,2,4-oxadiazol-5-yl)-3-methylbutanoate |
| SMILES | CCOC(=O)C(c1nc(Cc2ccccc2)no1)C(C)C |
| InChI | InChI=1S/C16H20N2O3/c1-4-20-16(19)14(11(2)3)15-17-13(18-21-15)10-12-8-6-5-7-9-12/h5-9,11,14H,4,10H2,1-3H3 |
| InChIKey | BKBZLVCFUZLVAJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |