C17H18ClN3O3 — CID 167829066
(3S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(3-chlorophenyl)propanoic acid (PubChem CID 167829066) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is (3S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(3-chlorophenyl)propanoic acid.
| Compound Name | (3S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(3-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 167829066 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | (3S)-3-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-3-(3-chlorophenyl)propanoic acid |
| SMILES | C#CCCC1(CCC(=O)N[C@@H](CC(=O)O)c2cccc(Cl)c2)N=N1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-2-3-8-17(20-21-17)9-7-15(22)19-14(11-16(23)24)12-5-4-6-13(18)10-12/h1,4-6,10,14H,3,7-9,11H2,(H,19,22)(H,23,24)/t14-/m0/s1 |
| InChIKey | CSBVFNQVAKPRSP-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|