C18H20N6O — CID 167889266
3-(3-but-3-ynyldiazirin-3-yl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]propanamide (PubChem CID 167889266) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]propanamide.
| Compound Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 167889266 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 3-(3-but-3-ynyldiazirin-3-yl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]propanamide |
| SMILES | C#CCCC1(CCC(=O)NC(Cn2cncn2)c2ccccc2)N=N1 |
| InChI | InChI=1S/C18H20N6O/c1-2-3-10-18(22-23-18)11-9-17(25)21-16(12-24-14-19-13-20-24)15-7-5-4-6-8-15/h1,4-8,13-14,16H,3,9-12H2,(H,21,25) |
| InChIKey | IHHGBXDVZAEJTD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|